C8H9N2O4Rb — CID 59864458
[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)ethylideneamino]azanide;rubidium(1+) (PubChem CID 59864458) has the molecular formula C8H9N2O4Rb and a molecular weight of 282.64 g/mol. Its IUPAC name is [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)ethylideneamino]azanide;rubidium(1+).
| Compound Name | [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)ethylideneamino]azanide;rubidium(1+) |
|---|---|
| PubChem CID | 59864458 |
| Molecular Formula | C8H9N2O4Rb |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)ethylideneamino]azanide;rubidium(1+) |
| SMILES | CC1(C)OC(=O)C(=CC=N[NH-])C(=O)O1.[Rb+] |
| InChI | InChI=1S/C8H10N2O4.Rb/c1-8(2)13-6(11)5(3-4-10-9)7(12)14-8;/h3-4H,1-2H3,(H2,9,11,12);/q;+1/p-1 |
| InChIKey | URYHJYSVPSXWDC-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|