About 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide
3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 59864727) has the molecular formula C13H17ClN4O2
and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 59864727 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CO[C@H]1CNCC[C@H]1NC(=O)c1[nH]c(C)c(C#N)c1Cl |
| InChI | InChI=1S/C13H17ClN4O2/c1-7-8(5-15)11(14)12(17-7)13(19)18-9-3-4-16-6-10(9)20-2/h9-10,16-17H,3-4,6H2,1-2H3,(H,18,19)/t9-,10+/m1/s1 |
| InChIKey | OGXHXFNLWUPLHB-ZJUUUORDSA-N |
| XLogP | 0.95 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The IUPAC name of 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (CID 59864727) is 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is CO[C@H]1CNCC[C@H]1NC(=O)c1[nH]c(C)c(C#N)c1Cl.
What is the InChIKey of 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The InChIKey is OGXHXFNLWUPLHB-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H17ClN4O2/c1-7-8(5-15)11(14)12(17-7)13(19)18-9-3-4-16-6-10(9)20-2/h9-10,16-17H,3-4,6H2,1-2H3,(H,18,19)/t9-,10+/m1/s1.
What are the key properties of 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide has a molecular weight of 296.76 g/mol, XLogP of 0.95, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-cyano-N-[(3S,4R)-3-methoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 59864727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).