C16H20ClN5O3S — CID 59864756
(3aR,4S,7R,7aS)-7-(7-chloro-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 59864756) has the molecular formula C16H20ClN5O3S and a molecular weight of 397.89 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-7-(7-chloro-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aR,4S,7R,7aS)-7-(7-chloro-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 59864756 |
| Molecular Formula | C16H20ClN5O3S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (3aR,4S,7R,7aS)-7-(7-chloro-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CCCSc1nc(Cl)c2nnn([C@@H]3C=C[C@H](O)[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C16H20ClN5O3S/c1-4-7-26-15-18-13(17)10-14(19-15)22(21-20-10)8-5-6-9(23)12-11(8)24-16(2,3)25-12/h5-6,8-9,11-12,23H,4,7H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | ZKXUGQYBVBAFIU-LLHIFLOGSA-N |
| XLogP | 2.37 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|