About (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole
(3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole (PubChem CID 59864780) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole |
| PubChem CID | 59864780 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole |
| SMILES | C[C@H]1C=C(C(C)(C)C)NN1C |
| InChI | InChI=1S/C9H18N2/c1-7-6-8(9(2,3)4)10-11(7)5/h6-7,10H,1-5H3/t7-/m0/s1 |
| InChIKey | YTEIIUZCPKHHAA-ZETCQYMHSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole?
The IUPAC name of (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole (CID 59864780) is (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole.
What is the SMILES notation for (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole?
The canonical SMILES for (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole is C[C@H]1C=C(C(C)(C)C)NN1C.
What is the InChIKey of (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole?
The InChIKey is YTEIIUZCPKHHAA-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H18N2/c1-7-6-8(9(2,3)4)10-11(7)5/h6-7,10H,1-5H3/t7-/m0/s1.
What are the key properties of (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole?
(3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole has a molecular weight of 154.26 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-tert-butyl-2,3-dimethyl-1,3-dihydropyrazole is sourced from PubChem (CID 59864780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).