C8H14N2O — CID 59864817
(5S)-N,1,5-trimethyl-2,5-dihydropyrrole-2-carboxamide (PubChem CID 59864817) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (5S)-N,1,5-trimethyl-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (5S)-N,1,5-trimethyl-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59864817 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (5S)-N,1,5-trimethyl-2,5-dihydropyrrole-2-carboxamide |
| SMILES | CNC(=O)C1C=C[C@H](C)N1C |
| InChI | InChI=1S/C8H14N2O/c1-6-4-5-7(10(6)3)8(11)9-2/h4-7H,1-3H3,(H,9,11)/t6-,7?/m0/s1 |
| InChIKey | PAJRODSHXSPTCX-PKPIPKONSA-N |
| XLogP | -0.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|