About (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole
(2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole (PubChem CID 59864831) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole |
| PubChem CID | 59864831 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole |
| SMILES | [C-]#[N+]C1=CN(C)[C@@H](C)N1 |
| InChI | InChI=1S/C6H9N3/c1-5-8-6(7-2)4-9(5)3/h4-5,8H,1,3H3/t5-/m0/s1 |
| InChIKey | QQQAMZQPSJHTTH-YFKPBYRVSA-N |
| XLogP | 0.59 |
| TPSA | 19.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole?
The IUPAC name of (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole (CID 59864831) is (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole.
What is the SMILES notation for (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole?
The canonical SMILES for (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole is [C-]#[N+]C1=CN(C)[C@@H](C)N1.
What is the InChIKey of (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole?
The InChIKey is QQQAMZQPSJHTTH-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9N3/c1-5-8-6(7-2)4-9(5)3/h4-5,8H,1,3H3/t5-/m0/s1.
What are the key properties of (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole?
(2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole has a molecular weight of 123.16 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-isocyano-2,3-dimethyl-1,2-dihydroimidazole is sourced from PubChem (CID 59864831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).