About 3-chloro-2,4,5-trimethyl-1H-pyrrole
3-chloro-2,4,5-trimethyl-1H-pyrrole (PubChem CID 59864853) has the molecular formula C7H10ClN
and a molecular weight of 143.62 g/mol. Its IUPAC name is 3-chloro-2,4,5-trimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3-chloro-2,4,5-trimethyl-1H-pyrrole |
| PubChem CID | 59864853 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3-chloro-2,4,5-trimethyl-1H-pyrrole |
| SMILES | Cc1[nH]c(C)c(Cl)c1C |
| InChI | InChI=1S/C7H10ClN/c1-4-5(2)9-6(3)7(4)8/h9H,1-3H3 |
| InChIKey | LQHFOKVNZLJGQC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-chloro-2,4,5-trimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,4,5-trimethyl-1H-pyrrole?
The IUPAC name of 3-chloro-2,4,5-trimethyl-1H-pyrrole (CID 59864853) is 3-chloro-2,4,5-trimethyl-1H-pyrrole.
What is the SMILES notation for 3-chloro-2,4,5-trimethyl-1H-pyrrole?
The canonical SMILES for 3-chloro-2,4,5-trimethyl-1H-pyrrole is Cc1[nH]c(C)c(Cl)c1C.
What is the InChIKey of 3-chloro-2,4,5-trimethyl-1H-pyrrole?
The InChIKey is LQHFOKVNZLJGQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN/c1-4-5(2)9-6(3)7(4)8/h9H,1-3H3.
What are the key properties of 3-chloro-2,4,5-trimethyl-1H-pyrrole?
3-chloro-2,4,5-trimethyl-1H-pyrrole has a molecular weight of 143.62 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,4,5-trimethyl-1H-pyrrole is sourced from PubChem (CID 59864853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).