About (2S)-1,2,4-trimethylpyrrolidine
(2S)-1,2,4-trimethylpyrrolidine (PubChem CID 59864868) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is (2S)-1,2,4-trimethylpyrrolidine.
Molecular Properties
| Compound Name | (2S)-1,2,4-trimethylpyrrolidine |
| PubChem CID | 59864868 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (2S)-1,2,4-trimethylpyrrolidine |
| SMILES | CC1C[C@H](C)N(C)C1 |
| InChI | InChI=1S/C7H15N/c1-6-4-7(2)8(3)5-6/h6-7H,4-5H2,1-3H3/t6?,7-/m0/s1 |
| InChIKey | SSTNJJXESKGKFV-MLWJPKLSSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1,2,4-trimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2,4-trimethylpyrrolidine?
The IUPAC name of (2S)-1,2,4-trimethylpyrrolidine (CID 59864868) is (2S)-1,2,4-trimethylpyrrolidine.
What is the SMILES notation for (2S)-1,2,4-trimethylpyrrolidine?
The canonical SMILES for (2S)-1,2,4-trimethylpyrrolidine is CC1C[C@H](C)N(C)C1.
What is the InChIKey of (2S)-1,2,4-trimethylpyrrolidine?
The InChIKey is SSTNJJXESKGKFV-MLWJPKLSSA-N. The full InChI is InChI=1S/C7H15N/c1-6-4-7(2)8(3)5-6/h6-7H,4-5H2,1-3H3/t6?,7-/m0/s1.
What are the key properties of (2S)-1,2,4-trimethylpyrrolidine?
(2S)-1,2,4-trimethylpyrrolidine has a molecular weight of 113.20 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2,4-trimethylpyrrolidine is sourced from PubChem (CID 59864868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).