About (2S)-1,2-dimethyl-2H-pyrazine
(2S)-1,2-dimethyl-2H-pyrazine (PubChem CID 59864903) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-2H-pyrazine.
Molecular Properties
| Compound Name | (2S)-1,2-dimethyl-2H-pyrazine |
| PubChem CID | 59864903 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (2S)-1,2-dimethyl-2H-pyrazine |
| SMILES | C[C@H]1C=NC=CN1C |
| InChI | InChI=1S/C6H10N2/c1-6-5-7-3-4-8(6)2/h3-6H,1-2H3/t6-/m0/s1 |
| InChIKey | VTMHPSIYGVWZDC-LURJTMIESA-N |
| XLogP | 0.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1,2-dimethyl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-dimethyl-2H-pyrazine?
The IUPAC name of (2S)-1,2-dimethyl-2H-pyrazine (CID 59864903) is (2S)-1,2-dimethyl-2H-pyrazine.
What is the SMILES notation for (2S)-1,2-dimethyl-2H-pyrazine?
The canonical SMILES for (2S)-1,2-dimethyl-2H-pyrazine is C[C@H]1C=NC=CN1C.
What is the InChIKey of (2S)-1,2-dimethyl-2H-pyrazine?
The InChIKey is VTMHPSIYGVWZDC-LURJTMIESA-N. The full InChI is InChI=1S/C6H10N2/c1-6-5-7-3-4-8(6)2/h3-6H,1-2H3/t6-/m0/s1.
What are the key properties of (2S)-1,2-dimethyl-2H-pyrazine?
(2S)-1,2-dimethyl-2H-pyrazine has a molecular weight of 110.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-dimethyl-2H-pyrazine is sourced from PubChem (CID 59864903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).