About 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate (PubChem CID 59865072) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate |
| PubChem CID | 59865072 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCOC(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-19(2,3)25-18(23)21-12-8-15(9-13-21)5-4-14-24-17(22)16-6-10-20-11-7-16/h6-7,10-11,15H,4-5,8-9,12-14H2,1-3H3 |
| InChIKey | PQYNNGXTVXEWKV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate?
The IUPAC name of 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate (CID 59865072) is 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate.
What is the SMILES notation for 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate?
The canonical SMILES for 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate is CC(C)(C)OC(=O)N1CCC(CCCOC(=O)c2ccncc2)CC1.
What is the InChIKey of 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate?
The InChIKey is PQYNNGXTVXEWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O4/c1-19(2,3)25-18(23)21-12-8-15(9-13-21)5-4-14-24-17(22)16-6-10-20-11-7-16/h6-7,10-11,15H,4-5,8-9,12-14H2,1-3H3.
What are the key properties of 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate?
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate has a molecular weight of 348.44 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propyl pyridine-4-carboxylate is sourced from PubChem (CID 59865072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).