About [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate
[(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate (PubChem CID 59865194) has the molecular formula C20H31NO5
and a molecular weight of 365.47 g/mol. Its IUPAC name is [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate |
| PubChem CID | 59865194 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C1NC(=O)CCCCCC(OC(C)=O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C20H31NO5/c1-14-10-11-18(26-17(4)23)8-6-5-7-9-19(24)21-20(14)15(2)12-13-25-16(3)22/h10-12,14,18,20H,5-9,13H2,1-4H3,(H,21,24)/b11-10+,15-12+/t14-,18?,20?/m0/s1 |
| InChIKey | YCKMRVZRQFEXHE-NPDKXWQRSA-N |
| XLogP | 3.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate?
The IUPAC name of [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate (CID 59865194) is [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate.
What is the SMILES notation for [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate?
The canonical SMILES for [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate is CC(=O)OC/C=C(\C)C1NC(=O)CCCCCC(OC(C)=O)/C=C/[C@@H]1C.
What is the InChIKey of [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate?
The InChIKey is YCKMRVZRQFEXHE-NPDKXWQRSA-N. The full InChI is InChI=1S/C20H31NO5/c1-14-10-11-18(26-17(4)23)8-6-5-7-9-19(24)21-20(14)15(2)12-13-25-16(3)22/h10-12,14,18,20H,5-9,13H2,1-4H3,(H,21,24)/b11-10+,15-12+/t14-,18?,20?/m0/s1.
What are the key properties of [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate?
[(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate has a molecular weight of 365.47 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[(3S,4E)-6-acetyloxy-3-methyl-12-oxo-1-azacyclododec-4-en-2-yl]but-2-enyl] acetate is sourced from PubChem (CID 59865194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).