C18H29NO4 — CID 59865199
[(3S,4E)-2-[(E)-4-hydroxybut-2-en-2-yl]-3-methyl-12-oxo-1-azacyclododec-4-en-6-yl] acetate (PubChem CID 59865199) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is [(3S,4E)-2-[(E)-4-hydroxybut-2-en-2-yl]-3-methyl-12-oxo-1-azacyclododec-4-en-6-yl] acetate.
| Compound Name | [(3S,4E)-2-[(E)-4-hydroxybut-2-en-2-yl]-3-methyl-12-oxo-1-azacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 59865199 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(3S,4E)-2-[(E)-4-hydroxybut-2-en-2-yl]-3-methyl-12-oxo-1-azacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)OC1/C=C/[C@H](C)C(/C(C)=C/CO)NC(=O)CCCCC1 |
| InChI | InChI=1S/C18H29NO4/c1-13-9-10-16(23-15(3)21)7-5-4-6-8-17(22)19-18(13)14(2)11-12-20/h9-11,13,16,18,20H,4-8,12H2,1-3H3,(H,19,22)/b10-9+,14-11+/t13-,16?,18?/m0/s1 |
| InChIKey | QSTYYFNZWVNIBV-IRYDSARQSA-N |
| XLogP | 2.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|