C21H12O — CID 59865264
1-dodeca-1,3,5,7,9,11-hexaynoxy-4-propan-2-ylbenzene (PubChem CID 59865264) has the molecular formula C21H12O and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-dodeca-1,3,5,7,9,11-hexaynoxy-4-propan-2-ylbenzene.
| Compound Name | 1-dodeca-1,3,5,7,9,11-hexaynoxy-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 59865264 |
| Molecular Formula | C21H12O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-dodeca-1,3,5,7,9,11-hexaynoxy-4-propan-2-ylbenzene |
| SMILES | C#CC#CC#CC#CC#CC#COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H12O/c1-4-5-6-7-8-9-10-11-12-13-18-22-21-16-14-20(15-17-21)19(2)3/h1,14-17,19H,2-3H3 |
| InChIKey | BCSAWRRDIFUZHP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|