About CID 59865384
CID 59865384 (PubChem CID 59865384) has the molecular formula C30H24IrN2O-2
and a molecular weight of 620.75 g/mol.
Molecular Properties
| Compound Name | CID 59865384 |
| PubChem CID | 59865384 |
| Molecular Formula | C30H24IrN2O-2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccc[c-]c2-c2nccc3cccc1c23.COc1cc[c-]c(-c2ccccn2)c1.[Ir] |
| InChI | InChI=1S/C18H14N.C12H10NO.Ir/c1-18(2)14-8-4-3-7-13(14)17-16-12(10-11-19-17)6-5-9-15(16)18;1-14-11-6-4-5-10(9-11)12-7-2-3-8-13-12;/h3-6,8-11H,1-2H3;2-4,6-9H,1H3;/q2*-1; |
| InChIKey | WYHNWTVOFLMYCE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59865384 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59865384?
The IUPAC name of CID 59865384 (CID 59865384) is not available.
What is the SMILES notation for CID 59865384?
The canonical SMILES for CID 59865384 is CC1(C)c2ccc[c-]c2-c2nccc3cccc1c23.COc1cc[c-]c(-c2ccccn2)c1.[Ir].
What is the InChIKey of CID 59865384?
The InChIKey is WYHNWTVOFLMYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N.C12H10NO.Ir/c1-18(2)14-8-4-3-7-13(14)17-16-12(10-11-19-17)6-5-9-15(16)18;1-14-11-6-4-5-10(9-11)12-7-2-3-8-13-12;/h3-6,8-11H,1-2H3;2-4,6-9H,1H3;/q2*-1;.
What are the key properties of CID 59865384?
CID 59865384 has a molecular weight of 620.75 g/mol, XLogP of 6.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59865384 is sourced from PubChem (CID 59865384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).