C27H56N4 — CID 59865453
2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-octadecamethyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecane (PubChem CID 59865453) has the molecular formula C27H56N4 and a molecular weight of 436.77 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-octadecamethyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecane.
| Compound Name | 2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-octadecamethyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecane |
|---|---|
| PubChem CID | 59865453 |
| Molecular Formula | C27H56N4 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.45 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-octadecamethyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecane |
| SMILES | CN1C(C)(C)C(C)(C)N(C)C(C)(C)C(C)(C)N2CN(C(C)(C)C1(C)C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C27H56N4/c1-20(2)21(3,4)29(18)23(7,8)25(11,12)31-19-30(26(13,14)27(31,15)16)24(9,10)22(5,6)28(20)17/h19H2,1-18H3 |
| InChIKey | MDIMVQZTBCVOSI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |