C13H24N4O3 — CID 59865490
1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarbaldehyde (PubChem CID 59865490) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarbaldehyde.
| Compound Name | 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarbaldehyde |
|---|---|
| PubChem CID | 59865490 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarbaldehyde |
| SMILES | O=CN1CCCN(C=O)CCN(C=O)CCCNCC1 |
| InChI | InChI=1S/C13H24N4O3/c18-11-15-6-2-7-17(13-20)10-9-16(12-19)5-1-3-14-4-8-15/h11-14H,1-10H2 |
| InChIKey | QDDAGPQIKAEDGP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|