C30H63N4+ — CID 59865507
1,2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-nonadecamethyl-10-propan-2-ylidene-1,4,7-triaza-10-azoniacyclododecane (PubChem CID 59865507) has the molecular formula C30H63N4+ and a molecular weight of 479.86 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-nonadecamethyl-10-propan-2-ylidene-1,4,7-triaza-10-azoniacyclododecane.
| Compound Name | 1,2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-nonadecamethyl-10-propan-2-ylidene-1,4,7-triaza-10-azoniacyclododecane |
|---|---|
| PubChem CID | 59865507 |
| Molecular Formula | C30H63N4+ |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.50 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6,7,8,8,9,9,11,11,12,12-nonadecamethyl-10-propan-2-ylidene-1,4,7-triaza-10-azoniacyclododecane |
| SMILES | CC(C)=[N+]1C(C)(C)C(C)(C)N(C)C(C)(C)C(C)(C)N(C)C(C)(C)C(C)(C)N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C30H63N4/c1-22(2)34-29(15,16)27(11,12)32(20)25(7,8)23(3,4)31(19)24(5,6)26(9,10)33(21)28(13,14)30(34,17)18/h1-21H3/q+1 |
| InChIKey | BIDHKMYBBDQPIQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|