About 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one
2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one (PubChem CID 59865592) has the molecular formula C13H8ClNOS
and a molecular weight of 261.73 g/mol. Its IUPAC name is 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one |
| PubChem CID | 59865592 |
| Molecular Formula | C13H8ClNOS |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one |
| SMILES | O=c1c2ccccc2sc2nc(CCl)ccc12 |
| InChI | InChI=1S/C13H8ClNOS/c14-7-8-5-6-10-12(16)9-3-1-2-4-11(9)17-13(10)15-8/h1-6H,7H2 |
| InChIKey | MGJQETZYGGWIFG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one?
The IUPAC name of 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one (CID 59865592) is 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one.
What is the SMILES notation for 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one?
The canonical SMILES for 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one is O=c1c2ccccc2sc2nc(CCl)ccc12.
What is the InChIKey of 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one?
The InChIKey is MGJQETZYGGWIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNOS/c14-7-8-5-6-10-12(16)9-3-1-2-4-11(9)17-13(10)15-8/h1-6H,7H2.
What are the key properties of 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one?
2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one has a molecular weight of 261.73 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)thiochromeno[2,3-b]pyridin-5-one is sourced from PubChem (CID 59865592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).