About N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide
N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide (PubChem CID 59865800) has the molecular formula C16H18ClFN2OS
and a molecular weight of 340.85 g/mol. Its IUPAC name is N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide.
Molecular Properties
| Compound Name | N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide |
| PubChem CID | 59865800 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide |
| SMILES | Cc1c(C(C)(C)C)s/c(=N/C(=O)c2cccc(Cl)c2F)n1C |
| InChI | InChI=1S/C16H18ClFN2OS/c1-9-13(16(2,3)4)22-15(20(9)5)19-14(21)10-7-6-8-11(17)12(10)18/h6-8H,1-5H3/b19-15+ |
| InChIKey | DPKXGRXRGWCZKJ-XDJHFCHBSA-N |
| XLogP | 4.23 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide?
The IUPAC name of N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide (CID 59865800) is N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide.
What is the SMILES notation for N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide?
The canonical SMILES for N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide is Cc1c(C(C)(C)C)s/c(=N/C(=O)c2cccc(Cl)c2F)n1C.
What is the InChIKey of N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide?
The InChIKey is DPKXGRXRGWCZKJ-XDJHFCHBSA-N. The full InChI is InChI=1S/C16H18ClFN2OS/c1-9-13(16(2,3)4)22-15(20(9)5)19-14(21)10-7-6-8-11(17)12(10)18/h6-8H,1-5H3/b19-15+.
What are the key properties of N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide?
N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide has a molecular weight of 340.85 g/mol, XLogP of 4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-tert-butyl-3,4-dimethyl-1,3-thiazol-2-ylidene)-3-chloro-2-fluorobenzamide is sourced from PubChem (CID 59865800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).