About 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide
4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 59865822) has the molecular formula C14H21NO2S
and a molecular weight of 267.39 g/mol. Its IUPAC name is 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 59865822 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)(C)c1ccccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H21NO2S/c1-14(2,3)12-6-4-5-7-13(12)15-8-10-18(16,17)11-9-15/h4-7H,8-11H2,1-3H3 |
| InChIKey | AOKILVCSCRLPSJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide (CID 59865822) is 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide is CC(C)(C)c1ccccc1N1CCS(=O)(=O)CC1.
What is the InChIKey of 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is AOKILVCSCRLPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2S/c1-14(2,3)12-6-4-5-7-13(12)15-8-10-18(16,17)11-9-15/h4-7H,8-11H2,1-3H3.
What are the key properties of 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide?
4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 267.39 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-tert-butylphenyl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 59865822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).