About N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide
N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide (PubChem CID 59865886) has the molecular formula C17H28N2OS
and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide |
| PubChem CID | 59865886 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide |
| SMILES | Cc1c(C(C)(C)C)s/c(=N\C(=O)C(C)(C)C)n1CC1CC1 |
| InChI | InChI=1S/C17H28N2OS/c1-11-13(16(2,3)4)21-15(18-14(20)17(5,6)7)19(11)10-12-8-9-12/h12H,8-10H2,1-7H3/b18-15- |
| InChIKey | NSDIUTDQHCAOFY-SDXDJHTJSA-N |
| XLogP | 4.04 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide?
The IUPAC name of N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide (CID 59865886) is N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide?
The canonical SMILES for N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide is Cc1c(C(C)(C)C)s/c(=N\C(=O)C(C)(C)C)n1CC1CC1.
What is the InChIKey of N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide?
The InChIKey is NSDIUTDQHCAOFY-SDXDJHTJSA-N. The full InChI is InChI=1S/C17H28N2OS/c1-11-13(16(2,3)4)21-15(18-14(20)17(5,6)7)19(11)10-12-8-9-12/h12H,8-10H2,1-7H3/b18-15-.
What are the key properties of N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide?
N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide has a molecular weight of 308.49 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-tert-butyl-3-(cyclopropylmethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,2-dimethylpropanamide is sourced from PubChem (CID 59865886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).