About 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine
2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine (PubChem CID 59866279) has the molecular formula C13H13FN2O
and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine |
| PubChem CID | 59866279 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine |
| SMILES | COc1nc(C)c(C)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN2O/c1-8-9(2)16-13(17-3)12(15-8)10-4-6-11(14)7-5-10/h4-7H,1-3H3 |
| InChIKey | OPDYRBOTUWVKEZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine?
The IUPAC name of 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine (CID 59866279) is 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine.
What is the SMILES notation for 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine?
The canonical SMILES for 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine is COc1nc(C)c(C)nc1-c1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine?
The InChIKey is OPDYRBOTUWVKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O/c1-8-9(2)16-13(17-3)12(15-8)10-4-6-11(14)7-5-10/h4-7H,1-3H3.
What are the key properties of 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine?
2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine has a molecular weight of 232.26 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-3-methoxy-5,6-dimethylpyrazine is sourced from PubChem (CID 59866279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).