About 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one
1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 59866622) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 59866622 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)C1C[C@H](O)CN1 |
| InChI | InChI=1S/C9H17NO2/c1-9(2,3)8(12)7-4-6(11)5-10-7/h6-7,10-11H,4-5H2,1-3H3/t6-,7?/m0/s1 |
| InChIKey | SEEGBLGGRMSFDU-PKPIPKONSA-N |
| XLogP | 0.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one (CID 59866622) is 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)C1C[C@H](O)CN1.
What is the InChIKey of 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The InChIKey is SEEGBLGGRMSFDU-PKPIPKONSA-N. The full InChI is InChI=1S/C9H17NO2/c1-9(2,3)8(12)7-4-6(11)5-10-7/h6-7,10-11H,4-5H2,1-3H3/t6-,7?/m0/s1.
What are the key properties of 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one has a molecular weight of 171.24 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 59866622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).