C38H50N4O — CID 59867175
2,3,7,8,12,13,17,18-octaethyl-10-methoxy-15-methyl-21,22-dihydroporphyrin (PubChem CID 59867175) has the molecular formula C38H50N4O and a molecular weight of 578.85 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-10-methoxy-15-methyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-10-methoxy-15-methyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 59867175 |
| Molecular Formula | C38H50N4O |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-10-methoxy-15-methyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(c(CC)c3CC)c(OC)c3nc(c2C)C(CC)=C3CC)c(CC)c1CC |
| InChI | InChI=1S/C38H50N4O/c1-11-22-23(12-2)31-20-33-25(14-4)27(16-6)36(41-33)38(43-10)37-29(18-8)28(17-7)35(42-37)21(9)34-26(15-5)24(13-3)32(40-34)19-30(22)39-31/h19-20,39,41H,11-18H2,1-10H3/b30-19-,31-20-,32-19-,33-20-,34-21-,35-21-,38-36+,38-37+ |
| InChIKey | IKQWFWZTXKDKNS-HHMKDGJGSA-N |
| XLogP | 10.34 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |