About N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine
N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine (PubChem CID 59867559) has the molecular formula C23H28N4
and a molecular weight of 360.51 g/mol. Its IUPAC name is N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine |
| PubChem CID | 59867559 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine |
| SMILES | Cc1cc(NCCCCCN(C)c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H28N4/c1-19-18-22(25-26-23(19)20-12-6-3-7-13-20)24-16-10-5-11-17-27(2)21-14-8-4-9-15-21/h3-4,6-9,12-15,18H,5,10-11,16-17H2,1-2H3,(H,24,25) |
| InChIKey | YSMCXOAGVGQMSK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine?
The IUPAC name of N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine (CID 59867559) is N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine.
What is the SMILES notation for N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine?
The canonical SMILES for N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine is Cc1cc(NCCCCCN(C)c2ccccc2)nnc1-c1ccccc1.
What is the InChIKey of N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine?
The InChIKey is YSMCXOAGVGQMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4/c1-19-18-22(25-26-23(19)20-12-6-3-7-13-20)24-16-10-5-11-17-27(2)21-14-8-4-9-15-21/h3-4,6-9,12-15,18H,5,10-11,16-17H2,1-2H3,(H,24,25).
What are the key properties of N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine?
N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine has a molecular weight of 360.51 g/mol, XLogP of 5.17, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(5-methyl-6-phenylpyridazin-3-yl)-N'-phenylpentane-1,5-diamine is sourced from PubChem (CID 59867559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).