C17H25NO5P+ — CID 59867598
[(1R,9R)-4-hydroxy-16-methyl-16-azoniatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-trien-16-yl]methyl dihydrogen phosphate (PubChem CID 59867598) has the molecular formula C17H25NO5P+ and a molecular weight of 354.36 g/mol. Its IUPAC name is [(1R,9R)-4-hydroxy-16-methyl-16-azoniatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-trien-16-yl]methyl dihydrogen phosphate.
| Compound Name | [(1R,9R)-4-hydroxy-16-methyl-16-azoniatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-trien-16-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59867598 |
| Molecular Formula | C17H25NO5P+ |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(1R,9R)-4-hydroxy-16-methyl-16-azoniatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-trien-16-yl]methyl dihydrogen phosphate |
| SMILES | C[N+]1(COP(=O)(O)O)C[C@]23CCCCC2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H24NO5P/c1-18(11-23-24(20,21)22)10-17-7-3-2-4-14(17)16(18)8-12-5-6-13(19)9-15(12)17/h5-6,9,14,16H,2-4,7-8,10-11H2,1H3,(H2-,19,20,21,22)/p+1/t14?,16-,17-,18?/m1/s1 |
| InChIKey | CBWWQWXROFAIGM-FZBQFSLMSA-O |
| XLogP | 2.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|