C22H32F6O2Si — CID 59867614
(4S,7aS)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 59867614) has the molecular formula C22H32F6O2Si and a molecular weight of 470.57 g/mol. Its IUPAC name is (4S,7aS)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (4S,7aS)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 59867614 |
| Molecular Formula | C22H32F6O2Si |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (4S,7aS)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@]12CCC[C@H](O)C1CC=C2C1(C/C=C/C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H32F6O2Si/c1-18-10-5-7-16(29)15(18)8-9-17(18)19(13-14-19)11-6-12-20(21(23,24)25,22(26,27)28)30-31(2,3)4/h6,9,12,15-16,29H,5,7-8,10-11,13-14H2,1-4H3/b12-6+/t15?,16-,18-/m0/s1 |
| InChIKey | CBHUVGNHIVMTLA-HZXXDALYSA-N |
| XLogP | 6.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|