C37H50N8O5 — CID 59868043
tert-butyl N-[[3-[3-[[[4-[[4-(4-acetylpiperazin-1-yl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]phenyl]methyl]carbamate (PubChem CID 59868043) has the molecular formula C37H50N8O5 and a molecular weight of 686.86 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-[[[4-[[4-(4-acetylpiperazin-1-yl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[3-[[[4-[[4-(4-acetylpiperazin-1-yl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59868043 |
| Molecular Formula | C37H50N8O5 |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | tert-butyl N-[[3-[3-[[[4-[[4-(4-acetylpiperazin-1-yl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]phenyl]methyl]carbamate |
| SMILES | CC(=O)N1CCN(C2CCC(CNc3nc(NCc4cccc(-c5cccc(CNC(=O)OC(C)(C)C)c5)c4C)ncc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C37H50N8O5/c1-25-30(10-7-11-32(25)29-9-6-8-28(20-29)22-41-36(47)50-37(3,4)5)23-39-35-40-24-33(45(48)49)34(42-35)38-21-27-12-14-31(15-13-27)44-18-16-43(17-19-44)26(2)46/h6-11,20,24,27,31H,12-19,21-23H2,1-5H3,(H,41,47)(H2,38,39,40,42) |
| InChIKey | LFHWMNHOXOTJSL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|