C10H8Cl2N6O — CID 59868395
4-(4,6-dichloro-1-ethylimidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 59868395) has the molecular formula C10H8Cl2N6O and a molecular weight of 299.12 g/mol. Its IUPAC name is 4-(4,6-dichloro-1-ethylimidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(4,6-dichloro-1-ethylimidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 59868395 |
| Molecular Formula | C10H8Cl2N6O |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-(4,6-dichloro-1-ethylimidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2c(Cl)nc(Cl)cc21 |
| InChI | InChI=1S/C10H8Cl2N6O/c1-2-18-4-3-5(11)14-8(12)6(4)15-10(18)7-9(13)17-19-16-7/h3H,2H2,1H3,(H2,13,17) |
| InChIKey | KEGUMQJRYMJAAW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|