C5H12N2 — CID 59868641
1,2,2,3,3,5,5,6,6-nonadeuterio-4-(trideuteriomethyl)piperazine (PubChem CID 59868641) has the molecular formula C5H12N2 and a molecular weight of 112.24 g/mol. Its IUPAC name is 1,2,2,3,3,5,5,6,6-nonadeuterio-4-(trideuteriomethyl)piperazine.
| Compound Name | 1,2,2,3,3,5,5,6,6-nonadeuterio-4-(trideuteriomethyl)piperazine |
|---|---|
| PubChem CID | 59868641 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 112.24 g/mol |
| Exact Mass | 112.18 |
| IUPAC Name | 1,2,2,3,3,5,5,6,6-nonadeuterio-4-(trideuteriomethyl)piperazine |
| SMILES | [2H]N1C([2H])([2H])C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C5H12N2/c1-7-4-2-6-3-5-7/h6H,2-5H2,1H3/i1D3,2D2,3D2,4D2,5D2/hD |
| InChIKey | PVOAHINGSUIXLS-SZJHRSPPSA-N |
| XLogP | -0.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |