C36H39F3N6O3 — CID 59868706
4-(4-benzylpiperazin-1-yl)-2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-3H-isoindol-1-one (PubChem CID 59868706) has the molecular formula C36H39F3N6O3 and a molecular weight of 660.74 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-3H-isoindol-1-one.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59868706 |
| Molecular Formula | C36H39F3N6O3 |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-3H-isoindol-1-one |
| SMILES | COc1ccc([C@@H](CCCNc2nccc(C(F)(F)F)n2)N2Cc3c(cccc3N3CCN(Cc4ccccc4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C36H39F3N6O3/c1-47-31-14-13-26(22-32(31)48-2)29(12-7-16-40-35-41-17-15-33(42-35)36(37,38)39)45-24-28-27(34(45)46)10-6-11-30(28)44-20-18-43(19-21-44)23-25-8-4-3-5-9-25/h3-6,8-11,13-15,17,22,29H,7,12,16,18-21,23-24H2,1-2H3,(H,40,41,42)/t29-/m1/s1 |
| InChIKey | UDUKFDYVUPFEGT-GDLZYMKVSA-N |
| XLogP | 6.42 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|