C31H37F3N6O3 — CID 59868711
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 59868711) has the molecular formula C31H37F3N6O3 and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59868711 |
| Molecular Formula | C31H37F3N6O3 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2nccc(C(F)(F)F)n2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H37F3N6O3/c1-4-38-15-17-39(18-16-38)25-8-5-7-22-23(25)20-40(29(22)41)24(21-10-11-26(42-2)27(19-21)43-3)9-6-13-35-30-36-14-12-28(37-30)31(32,33)34/h5,7-8,10-12,14,19,24H,4,6,9,13,15-18,20H2,1-3H3,(H,35,36,37)/t24-/m1/s1 |
| InChIKey | YQQYJBONKMDASO-XMMPIXPASA-N |
| XLogP | 5.24 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|