C29H33F3N6O3 — CID 59868713
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-piperazin-1-yl-3H-isoindol-1-one (PubChem CID 59868713) has the molecular formula C29H33F3N6O3 and a molecular weight of 570.62 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-piperazin-1-yl-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-piperazin-1-yl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59868713 |
| Molecular Formula | C29H33F3N6O3 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butyl]-4-piperazin-1-yl-3H-isoindol-1-one |
| SMILES | COc1ccc([C@@H](CCCNc2nccc(C(F)(F)F)n2)N2Cc3c(cccc3N3CCNCC3)C2=O)cc1OC |
| InChI | InChI=1S/C29H33F3N6O3/c1-40-24-9-8-19(17-25(24)41-2)22(7-4-11-34-28-35-12-10-26(36-28)29(30,31)32)38-18-21-20(27(38)39)5-3-6-23(21)37-15-13-33-14-16-37/h3,5-6,8-10,12,17,22,33H,4,7,11,13-16,18H2,1-2H3,(H,34,35,36)/t22-/m1/s1 |
| InChIKey | VWPFGWGMGAWYFM-JOCHJYFZSA-N |
| XLogP | 4.51 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|