C10H19NO — CID 59868894
(4S,5S)-1-ethyl-3,3,4,5-tetramethylpyrrolidin-2-one (PubChem CID 59868894) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (4S,5S)-1-ethyl-3,3,4,5-tetramethylpyrrolidin-2-one.
| Compound Name | (4S,5S)-1-ethyl-3,3,4,5-tetramethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 59868894 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (4S,5S)-1-ethyl-3,3,4,5-tetramethylpyrrolidin-2-one |
| SMILES | CCN1C(=O)C(C)(C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H19NO/c1-6-11-8(3)7(2)10(4,5)9(11)12/h7-8H,6H2,1-5H3/t7-,8+/m1/s1 |
| InChIKey | RXWVASRYLIWJBT-SFYZADRCSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |