About 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane
2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane (PubChem CID 59869460) has the molecular formula C15H18Br2O3
and a molecular weight of 406.11 g/mol. Its IUPAC name is 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane |
| PubChem CID | 59869460 |
| Molecular Formula | C15H18Br2O3 |
| Molecular Weight | 406.11 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane |
| SMILES | Brc1cc(Br)c(OCCCCC2CO2)c(CC2CO2)c1 |
| InChI | InChI=1S/C15H18Br2O3/c16-11-5-10(6-13-9-20-13)15(14(17)7-11)18-4-2-1-3-12-8-19-12/h5,7,12-13H,1-4,6,8-9H2 |
| InChIKey | LMILBZVKHKMOAZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane?
The IUPAC name of 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane (CID 59869460) is 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane.
What is the SMILES notation for 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane?
The canonical SMILES for 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane is Brc1cc(Br)c(OCCCCC2CO2)c(CC2CO2)c1.
What is the InChIKey of 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane?
The InChIKey is LMILBZVKHKMOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Br2O3/c16-11-5-10(6-13-9-20-13)15(14(17)7-11)18-4-2-1-3-12-8-19-12/h5,7,12-13H,1-4,6,8-9H2.
What are the key properties of 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane?
2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane has a molecular weight of 406.11 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dibromo-2-[4-(oxiran-2-yl)butoxy]phenyl]methyl]oxirane is sourced from PubChem (CID 59869460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).