C37H42N2O — CID 59869602
(1E,3E)-1,3-bis(1-butyl-3,3-dimethylindol-2-ylidene)inden-2-one (PubChem CID 59869602) has the molecular formula C37H42N2O and a molecular weight of 530.76 g/mol. Its IUPAC name is (1E,3E)-1,3-bis(1-butyl-3,3-dimethylindol-2-ylidene)inden-2-one.
| Compound Name | (1E,3E)-1,3-bis(1-butyl-3,3-dimethylindol-2-ylidene)inden-2-one |
|---|---|
| PubChem CID | 59869602 |
| Molecular Formula | C37H42N2O |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | (1E,3E)-1,3-bis(1-butyl-3,3-dimethylindol-2-ylidene)inden-2-one |
| SMILES | CCCCN1/C(=C2/C(=O)/C(=C3/N(CCCC)c4ccccc4C3(C)C)c3ccccc32)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H42N2O/c1-7-9-23-38-29-21-15-13-19-27(29)36(3,4)34(38)31-25-17-11-12-18-26(25)32(33(31)40)35-37(5,6)28-20-14-16-22-30(28)39(35)24-10-8-2/h11-22H,7-10,23-24H2,1-6H3/b34-31+,35-32+ |
| InChIKey | GVOCUHCUSKKODL-UTMVNRITSA-N |
| XLogP | 8.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|