About 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium
2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium (PubChem CID 59870360) has the molecular formula C6H14NRfS-
and a molecular weight of 399.25 g/mol. Its IUPAC name is 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium |
| PubChem CID | 59870360 |
| Molecular Formula | C6H14NRfS- |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium |
| SMILES | [CH2-]CSCCN(C)C.[Rf] |
| InChI | InChI=1S/C6H14NS.Rf/c1-4-8-6-5-7(2)3;/h1,4-6H2,2-3H3;/q-1; |
| InChIKey | QSQYZAVVCOSPNL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium?
The IUPAC name of 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium (CID 59870360) is 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium.
What is the SMILES notation for 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium?
The canonical SMILES for 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium is [CH2-]CSCCN(C)C.[Rf].
What is the InChIKey of 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium?
The InChIKey is QSQYZAVVCOSPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NS.Rf/c1-4-8-6-5-7(2)3;/h1,4-6H2,2-3H3;/q-1;.
What are the key properties of 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium?
2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium has a molecular weight of 399.25 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-N,N-dimethylethanamine;rutherfordium is sourced from PubChem (CID 59870360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).