C18H36N2O3 — CID 59870425
N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2,2,3,3,6-pentamethyl-5-oxoheptanamide (PubChem CID 59870425) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2,2,3,3,6-pentamethyl-5-oxoheptanamide.
| Compound Name | N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2,2,3,3,6-pentamethyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 59870425 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2,2,3,3,6-pentamethyl-5-oxoheptanamide |
| SMILES | CC(C)C(=O)CC(C)(C)C(C)(C)C(=O)N[C@@H](C)[C@H](O)CN(C)C |
| InChI | InChI=1S/C18H36N2O3/c1-12(2)14(21)10-17(4,5)18(6,7)16(23)19-13(3)15(22)11-20(8)9/h12-13,15,22H,10-11H2,1-9H3,(H,19,23)/t13-,15+/m0/s1 |
| InChIKey | KFKRWVKDCIXBHD-DZGCQCFKSA-N |
| XLogP | 2.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |