About [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate
[(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate (PubChem CID 59870642) has the molecular formula C14H9ClN4O4
and a molecular weight of 332.70 g/mol. Its IUPAC name is [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate.
Molecular Properties
| Compound Name | [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate |
| PubChem CID | 59870642 |
| Molecular Formula | C14H9ClN4O4 |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate |
| SMILES | C=COC(=O)O[C@H]1c2nccnc2C(=O)N1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H9ClN4O4/c1-2-22-14(21)23-13-11-10(16-5-6-17-11)12(20)19(13)9-4-3-8(15)7-18-9/h2-7,13H,1H2/t13-/m0/s1 |
| InChIKey | FSLYFZQIONWLKR-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate?
The IUPAC name of [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate (CID 59870642) is [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate.
What is the SMILES notation for [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate?
The canonical SMILES for [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate is C=COC(=O)O[C@H]1c2nccnc2C(=O)N1c1ccc(Cl)cn1.
What is the InChIKey of [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate?
The InChIKey is FSLYFZQIONWLKR-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H9ClN4O4/c1-2-22-14(21)23-13-11-10(16-5-6-17-11)12(20)19(13)9-4-3-8(15)7-18-9/h2-7,13H,1H2/t13-/m0/s1.
What are the key properties of [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate?
[(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate has a molecular weight of 332.70 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] ethenyl carbonate is sourced from PubChem (CID 59870642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).