C11H16ClN — CID 59871381
(2R)-1-(4-chlorophenyl)-N,N-dimethylpropan-2-amine (PubChem CID 59871381) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (2R)-1-(4-chlorophenyl)-N,N-dimethylpropan-2-amine.
| Compound Name | (2R)-1-(4-chlorophenyl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 59871381 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2R)-1-(4-chlorophenyl)-N,N-dimethylpropan-2-amine |
| SMILES | C[C@H](Cc1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C11H16ClN/c1-9(13(2)3)8-10-4-6-11(12)7-5-10/h4-7,9H,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | DUZIUJWBWTXQGI-SECBINFHSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |