C10H17NO2 — CID 59871609
1,8a-dimethyl-4,4a,5,6,7,8-hexahydrobenzo[d][1,3]oxazin-2-one (PubChem CID 59871609) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1,8a-dimethyl-4,4a,5,6,7,8-hexahydrobenzo[d][1,3]oxazin-2-one.
| Compound Name | 1,8a-dimethyl-4,4a,5,6,7,8-hexahydrobenzo[d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 59871609 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1,8a-dimethyl-4,4a,5,6,7,8-hexahydrobenzo[d][1,3]oxazin-2-one |
| SMILES | CN1C(=O)OCC2CCCCC21C |
| InChI | InChI=1S/C10H17NO2/c1-10-6-4-3-5-8(10)7-13-9(12)11(10)2/h8H,3-7H2,1-2H3 |
| InChIKey | SEANPWYFSYISQP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |