C22H30ClN — CID 59871720
1-[4-[5-[4-(chloromethyl)phenyl]hexan-2-yl]phenyl]-N,N-dimethylmethanamine (PubChem CID 59871720) has the molecular formula C22H30ClN and a molecular weight of 343.94 g/mol. Its IUPAC name is 1-[4-[5-[4-(chloromethyl)phenyl]hexan-2-yl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[5-[4-(chloromethyl)phenyl]hexan-2-yl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 59871720 |
| Molecular Formula | C22H30ClN |
| Molecular Weight | 343.94 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[4-[5-[4-(chloromethyl)phenyl]hexan-2-yl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CC(CCC(C)c1ccc(CN(C)C)cc1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C22H30ClN/c1-17(21-11-7-19(15-23)8-12-21)5-6-18(2)22-13-9-20(10-14-22)16-24(3)4/h7-14,17-18H,5-6,15-16H2,1-4H3 |
| InChIKey | KHVRCJWMUCSEGJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.94 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|