C44H56O2W — CID 59872051
ethoxycyclohexane;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-[2-(2,3,5,6-tetramethylbenzene-4-id-1-yl)ethynyl]phenyl]ethynyl]benzene;tungsten(2+) (PubChem CID 59872051) has the molecular formula C44H56O2W and a molecular weight of 800.77 g/mol. Its IUPAC name is ethoxycyclohexane;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-[2-(2,3,5,6-tetramethylbenzene-4-id-1-yl)ethynyl]phenyl]ethynyl]benzene;tungsten(2+).
| Compound Name | ethoxycyclohexane;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-[2-(2,3,5,6-tetramethylbenzene-4-id-1-yl)ethynyl]phenyl]ethynyl]benzene;tungsten(2+) |
|---|---|
| PubChem CID | 59872051 |
| Molecular Formula | C44H56O2W |
| Molecular Weight | 800.77 g/mol |
| Exact Mass | 800.38 |
| IUPAC Name | ethoxycyclohexane;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-[2-(2,3,5,6-tetramethylbenzene-4-id-1-yl)ethynyl]phenyl]ethynyl]benzene;tungsten(2+) |
| SMILES | CCOC1CC[CH-]CC1.CCOc1c(C)c(C)c(C#Cc2c(C)c(C)c(C#Cc3c(C)c(C)[c-]c(C)c3C)c(C)c2C)c(C)c1C.[W+2] |
| InChI | InChI=1S/C36H41O.C8H15O.W/c1-14-37-36-30(12)28(10)35(29(11)31(36)13)18-17-34-26(8)24(6)33(25(7)27(34)9)16-15-32-22(4)20(2)19-21(3)23(32)5;1-2-9-8-6-4-3-5-7-8;/h14H2,1-13H3;3,8H,2,4-7H2,1H3;/q2*-1;+2 |
| InChIKey | SNXWZRHXJZTUDG-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.77 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|