C10H14F3N3O — CID 59872717
7-methyl-1-methylidene-2-(2,2,2-trifluoroethyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 59872717) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 7-methyl-1-methylidene-2-(2,2,2-trifluoroethyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-methyl-1-methylidene-2-(2,2,2-trifluoroethyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 59872717 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 7-methyl-1-methylidene-2-(2,2,2-trifluoroethyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | C=C1C2CN(C)CCN2C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O/c1-7-8-5-14(2)3-4-15(8)9(17)16(7)6-10(11,12)13/h8H,1,3-6H2,2H3 |
| InChIKey | BQXFUWPGSUYPPT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |