C19H26 — CID 59872941
1,2,3,4,5,6-hexamethyl-7-propylnaphthalene (PubChem CID 59872941) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethyl-7-propylnaphthalene.
| Compound Name | 1,2,3,4,5,6-hexamethyl-7-propylnaphthalene |
|---|---|
| PubChem CID | 59872941 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1,2,3,4,5,6-hexamethyl-7-propylnaphthalene |
| SMILES | CCCc1cc2c(C)c(C)c(C)c(C)c2c(C)c1C |
| InChI | InChI=1S/C19H26/c1-8-9-17-10-18-14(5)11(2)12(3)15(6)19(18)16(7)13(17)4/h10H,8-9H2,1-7H3 |
| InChIKey | PZGKOGXFDFCSBZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |