About CID 59873065
CID 59873065 (PubChem CID 59873065) has the molecular formula C18H17N4O2
and a molecular weight of 321.36 g/mol.
Molecular Properties
| Compound Name | CID 59873065 |
| PubChem CID | 59873065 |
| Molecular Formula | C18H17N4O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | — |
| SMILES | N#CC1C(=O)[N]C(=O)C(C#N)C12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C18H17N4O2/c19-10-14-16(23)21-17(24)15(11-20)18(14)6-8-22(9-7-18)12-13-4-2-1-3-5-13/h1-5,14-15H,6-9,12H2 |
| InChIKey | WGAQNZOMPUKLQB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 59873065 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59873065?
The IUPAC name of CID 59873065 (CID 59873065) is not available.
What is the SMILES notation for CID 59873065?
The canonical SMILES for CID 59873065 is N#CC1C(=O)[N]C(=O)C(C#N)C12CCN(Cc1ccccc1)CC2.
What is the InChIKey of CID 59873065?
The InChIKey is WGAQNZOMPUKLQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N4O2/c19-10-14-16(23)21-17(24)15(11-20)18(14)6-8-22(9-7-18)12-13-4-2-1-3-5-13/h1-5,14-15H,6-9,12H2.
What are the key properties of CID 59873065?
CID 59873065 has a molecular weight of 321.36 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59873065 is sourced from PubChem (CID 59873065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).