About (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol
(2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol (PubChem CID 59873102) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol.
Molecular Properties
| Compound Name | (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol |
| PubChem CID | 59873102 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol |
| SMILES | Cc1nc2c(c(C)c1CO)Cc1ccccc1C2 |
| InChI | InChI=1S/C16H17NO/c1-10-14-7-12-5-3-4-6-13(12)8-16(14)17-11(2)15(10)9-18/h3-6,18H,7-9H2,1-2H3 |
| InChIKey | JGQADZHPRDZSOV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol?
The IUPAC name of (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol (CID 59873102) is (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol.
What is the SMILES notation for (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol?
The canonical SMILES for (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol is Cc1nc2c(c(C)c1CO)Cc1ccccc1C2.
What is the InChIKey of (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol?
The InChIKey is JGQADZHPRDZSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-10-14-7-12-5-3-4-6-13(12)8-16(14)17-11(2)15(10)9-18/h3-6,18H,7-9H2,1-2H3.
What are the key properties of (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol?
(2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol has a molecular weight of 239.32 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-5,10-dihydrobenzo[g]quinolin-3-yl)methanol is sourced from PubChem (CID 59873102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).