C35H67N9O3 — CID 59873146
2-[4-[[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol (PubChem CID 59873146) has the molecular formula C35H67N9O3 and a molecular weight of 661.98 g/mol. Its IUPAC name is 2-[4-[[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 59873146 |
| Molecular Formula | C35H67N9O3 |
| Molecular Weight | 661.98 g/mol |
| Exact Mass | 661.54 |
| IUPAC Name | 2-[4-[[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
| SMILES | CN(c1nc(N(C)C2CC(C)(C)N(O)C(C)(C)C2)nc(N(C)C2CC(C)(C)N(CCO)C(C)(C)C2)n1)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C35H67N9O3/c1-30(2)18-24(19-31(3,4)42(30)16-17-45)39(13)27-36-28(40(14)25-20-32(5,6)43(46)33(7,8)21-25)38-29(37-27)41(15)26-22-34(9,10)44(47)35(11,12)23-26/h24-26,45-47H,16-23H2,1-15H3 |
| InChIKey | GUAVXXAGLQYGCU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |