About CID 59873342
CID 59873342 (PubChem CID 59873342) has the molecular formula C18H35O3S
and a molecular weight of 331.54 g/mol.
Molecular Properties
| Compound Name | CID 59873342 |
| PubChem CID | 59873342 |
| Molecular Formula | C18H35O3S |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCSCC(O)C[CH]OC(C)=O |
| InChI | InChI=1S/C18H35O3S/c1-3-4-5-6-7-8-9-10-11-12-15-22-16-18(20)13-14-21-17(2)19/h14,18,20H,3-13,15-16H2,1-2H3 |
| InChIKey | LZCYMVHXAJLDCR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59873342 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59873342?
The IUPAC name of CID 59873342 (CID 59873342) is not available.
What is the SMILES notation for CID 59873342?
The canonical SMILES for CID 59873342 is CCCCCCCCCCCCSCC(O)C[CH]OC(C)=O.
What is the InChIKey of CID 59873342?
The InChIKey is LZCYMVHXAJLDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35O3S/c1-3-4-5-6-7-8-9-10-11-12-15-22-16-18(20)13-14-21-17(2)19/h14,18,20H,3-13,15-16H2,1-2H3.
What are the key properties of CID 59873342?
CID 59873342 has a molecular weight of 331.54 g/mol, XLogP of 5.12, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59873342 is sourced from PubChem (CID 59873342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).