About N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide
N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide (PubChem CID 59873974) has the molecular formula C12H25NO5
and a molecular weight of 263.33 g/mol. Its IUPAC name is N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide |
| PubChem CID | 59873974 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide |
| SMILES | COCC(CN(C(C)=O)C(C)C)OCC(O)CO |
| InChI | InChI=1S/C12H25NO5/c1-9(2)13(10(3)15)5-12(8-17-4)18-7-11(16)6-14/h9,11-12,14,16H,5-8H2,1-4H3 |
| InChIKey | RVZUZUVHVRUYRE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide?
The IUPAC name of N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide (CID 59873974) is N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide.
What is the SMILES notation for N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide?
The canonical SMILES for N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide is COCC(CN(C(C)=O)C(C)C)OCC(O)CO.
What is the InChIKey of N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide?
The InChIKey is RVZUZUVHVRUYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO5/c1-9(2)13(10(3)15)5-12(8-17-4)18-7-11(16)6-14/h9,11-12,14,16H,5-8H2,1-4H3.
What are the key properties of N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide?
N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide has a molecular weight of 263.33 g/mol, XLogP of -0.37, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydroxypropoxy)-3-methoxypropyl]-N-propan-2-ylacetamide is sourced from PubChem (CID 59873974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).